ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
název výrobku |
Benzo[b]thiophene-2-carbonyl chloride |
Synonyma |
Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
Molekulární vzorec |
C9H5ClOS |
Molekulová hmotnost |
196.6534 |
InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
Registrační číslo CAS |
39827-11-7 |
Molekulární struktura |
|
Hustota |
1.41g/cm3 |
Bod tání |
85℃ |
Bod varu |
309.5°C at 760 mmHg |
Index lomu |
1.68 |
Bod vzplanutí |
141°C |
Symbolů nebezpečnosti |
C:Corrosive;
|
Riziko Codes |
R34:Causes burns.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|